C22H19F2NO3 — CID 148829384
1-[3-(difluoromethoxy)phenyl]-3-[3-(hydroxymethyl)-4-pyridin-4-ylphenyl]propan-2-one (PubChem CID 148829384) has the molecular formula C22H19F2NO3 and a molecular weight of 383.39 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[3-(hydroxymethyl)-4-pyridin-4-ylphenyl]propan-2-one.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[3-(hydroxymethyl)-4-pyridin-4-ylphenyl]propan-2-one |
|---|---|
| PubChem CID | 148829384 |
| Molecular Formula | C22H19F2NO3 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[3-(hydroxymethyl)-4-pyridin-4-ylphenyl]propan-2-one |
| SMILES | O=C(Cc1cccc(OC(F)F)c1)Cc1ccc(-c2ccncc2)c(CO)c1 |
| InChI | InChI=1S/C22H19F2NO3/c23-22(24)28-20-3-1-2-15(13-20)11-19(27)12-16-4-5-21(18(10-16)14-26)17-6-8-25-9-7-17/h1-10,13,22,26H,11-12,14H2 |
| InChIKey | OTJHJMZUCNUCAK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |