C9H7NO2 — CID 148830784
5-nitroso-2,3-dihydroinden-1-one (PubChem CID 148830784) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-nitroso-2,3-dihydroinden-1-one.
| Compound Name | 5-nitroso-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 148830784 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 5-nitroso-2,3-dihydroinden-1-one |
| SMILES | O=Nc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C9H7NO2/c11-9-4-1-6-5-7(10-12)2-3-8(6)9/h2-3,5H,1,4H2 |
| InChIKey | OTQHDDAEWCKBSX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |