C19H20N2O4 — CID 148844189
pyridin-3-ylmethyl 2-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 148844189) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | pyridin-3-ylmethyl 2-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 148844189 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | pyridin-3-ylmethyl 2-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | O=C(CC1CCc2ccc(C(=O)NO)cc2C1)OCc1cccnc1 |
| InChI | InChI=1S/C19H20N2O4/c22-18(25-12-14-2-1-7-20-11-14)9-13-3-4-15-5-6-16(19(23)21-24)10-17(15)8-13/h1-2,5-7,10-11,13,24H,3-4,8-9,12H2,(H,21,23) |
| InChIKey | OWDCKOYJSWDORT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|