C18H17F2NO4S — CID 158319382
7-[(2,4-difluorophenyl)sulfonylmethyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 158319382) has the molecular formula C18H17F2NO4S and a molecular weight of 381.40 g/mol. Its IUPAC name is 7-[(2,4-difluorophenyl)sulfonylmethyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 7-[(2,4-difluorophenyl)sulfonylmethyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 158319382 |
| Molecular Formula | C18H17F2NO4S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 7-[(2,4-difluorophenyl)sulfonylmethyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CC(CS(=O)(=O)c1ccc(F)cc1F)CC2 |
| InChI | InChI=1S/C18H17F2NO4S/c19-15-5-6-17(16(20)9-15)26(24,25)10-11-1-2-12-3-4-13(18(22)21-23)8-14(12)7-11/h3-6,8-9,11,23H,1-2,7,10H2,(H,21,22) |
| InChIKey | GOQPODASBLEZDV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|