C18H17ClN2O4 — CID 56602367
(4-chlorophenyl) N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 56602367) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is (4-chlorophenyl) N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | (4-chlorophenyl) N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 56602367 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (4-chlorophenyl) N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | O=C(NC1CCc2ccc(C(=O)NO)cc2C1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O4/c19-14-4-7-16(8-5-14)25-18(23)20-15-6-3-11-1-2-12(17(22)21-24)9-13(11)10-15/h1-2,4-5,7-9,15,24H,3,6,10H2,(H,20,23)(H,21,22) |
| InChIKey | ILXMGXWRBWYLSG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|