C16H22N2O3 — CID 86731183
(7S)-7-(2,2-dimethylpropanoylamino)-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 86731183) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (7S)-7-(2,2-dimethylpropanoylamino)-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | (7S)-7-(2,2-dimethylpropanoylamino)-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 86731183 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (7S)-7-(2,2-dimethylpropanoylamino)-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(C)(C)C(=O)N[C@H]1CCc2ccc(C(=O)NO)cc2C1 |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)15(20)17-13-7-6-10-4-5-11(14(19)18-21)8-12(10)9-13/h4-5,8,13,21H,6-7,9H2,1-3H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | NADPZHAXQMQBCU-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|