C21H29NO5 — CID 90368246
oxan-2-yl (7S)-7-(2,2-dimethylpropanoylamino)-5,6,7,8-tetrahydronaphthalene-2-carboperoxoate (PubChem CID 90368246) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is oxan-2-yl (7S)-7-(2,2-dimethylpropanoylamino)-5,6,7,8-tetrahydronaphthalene-2-carboperoxoate.
| Compound Name | oxan-2-yl (7S)-7-(2,2-dimethylpropanoylamino)-5,6,7,8-tetrahydronaphthalene-2-carboperoxoate |
|---|---|
| PubChem CID | 90368246 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | oxan-2-yl (7S)-7-(2,2-dimethylpropanoylamino)-5,6,7,8-tetrahydronaphthalene-2-carboperoxoate |
| SMILES | CC(C)(C)C(=O)N[C@H]1CCc2ccc(C(=O)OOC3CCCCO3)cc2C1 |
| InChI | InChI=1S/C21H29NO5/c1-21(2,3)20(24)22-17-10-9-14-7-8-15(12-16(14)13-17)19(23)27-26-18-6-4-5-11-25-18/h7-8,12,17-18H,4-6,9-11,13H2,1-3H3,(H,22,24)/t17-,18?/m0/s1 |
| InChIKey | NIEDOGLYJAKBNM-ZENAZSQFSA-N |
| XLogP | 3.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|