C16H16N2O3 — CID 58055501
N-hydroxy-7-pyridin-4-yloxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 58055501) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-hydroxy-7-pyridin-4-yloxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-7-pyridin-4-yloxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58055501 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-hydroxy-7-pyridin-4-yloxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CC(Oc1ccncc1)CC2 |
| InChI | InChI=1S/C16H16N2O3/c19-16(18-20)12-2-1-11-3-4-15(10-13(11)9-12)21-14-5-7-17-8-6-14/h1-2,5-9,15,20H,3-4,10H2,(H,18,19) |
| InChIKey | BEZYFTRQCMJNEU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|