C21H23N3O3 — CID 58055390
N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 58055390) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 58055390 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[7-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CC(NC(=O)C1Cc3ccccc3CN1)CC2 |
| InChI | InChI=1S/C21H23N3O3/c25-20(24-27)15-6-5-13-7-8-18(10-17(13)9-15)23-21(26)19-11-14-3-1-2-4-16(14)12-22-19/h1-6,9,18-19,22,27H,7-8,10-12H2,(H,23,26)(H,24,25) |
| InChIKey | YAPHUWNYLPLAIC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|