C23H21FN2O4S — CID 87220054
3-[3-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide (PubChem CID 87220054) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide.
| Compound Name | 3-[3-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide |
|---|---|
| PubChem CID | 87220054 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 3-[3-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CCN(S(=O)(=O)c1cccc(-c3ccc(F)cc3)c1)CC2 |
| InChI | InChI=1S/C23H21FN2O4S/c24-21-8-6-16(7-9-21)18-2-1-3-22(15-18)31(29,30)26-12-10-17-4-5-20(23(27)25-28)14-19(17)11-13-26/h1-9,14-15,28H,10-13H2,(H,25,27) |
| InChIKey | HDRONPAVWIFDGF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|