C23H34NO2+ — CID 148852800
[(14R,17R,19R)-17-hydroxy-14-methyl-8-oxo-19-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl]-methylidyneazanium (PubChem CID 148852800) has the molecular formula C23H34NO2+ and a molecular weight of 356.53 g/mol. Its IUPAC name is [(14R,17R,19R)-17-hydroxy-14-methyl-8-oxo-19-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl]-methylidyneazanium.
| Compound Name | [(14R,17R,19R)-17-hydroxy-14-methyl-8-oxo-19-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl]-methylidyneazanium |
|---|---|
| PubChem CID | 148852800 |
| Molecular Formula | C23H34NO2+ |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | [(14R,17R,19R)-17-hydroxy-14-methyl-8-oxo-19-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl]-methylidyneazanium |
| SMILES | C#[N+][C@@]12CCC3C4CCC5CCC(=O)CC54CCC3[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C23H34NO2/c1-21-10-7-17(26)14-23(21,24-2)12-8-18-19(21)9-11-22-13-16(25)5-3-15(22)4-6-20(18)22/h2,15,17-20,26H,3-14H2,1H3/q+1/t15?,17-,18?,19?,20?,21-,22?,23-/m1/s1 |
| InChIKey | ASAHVKMGFVYACG-XQUNVXAJSA-N |
| XLogP | 4.82 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |