C8H16BNO — CID 148887826
CID 148887826 (PubChem CID 148887826) has the molecular formula C8H16BNO and a molecular weight of 153.03 g/mol.
| Compound Name | CID 148887826 |
|---|---|
| PubChem CID | 148887826 |
| Molecular Formula | C8H16BNO |
| Molecular Weight | 153.03 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | — |
| SMILES | [B]CC(C)NCC1(CO)CC1 |
| InChI | InChI=1S/C8H16BNO/c1-7(4-9)10-5-8(6-11)2-3-8/h7,10-11H,2-6H2,1H3 |
| InChIKey | SAUNEIIOMCCFQX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.03 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|