C10H21NO3 — CID 115454495
[1-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopropyl]methanol (PubChem CID 115454495) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is [1-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115454495 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | [1-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopropyl]methanol |
| SMILES | COC(OC)C(C)NCC1(CO)CC1 |
| InChI | InChI=1S/C10H21NO3/c1-8(9(13-2)14-3)11-6-10(7-12)4-5-10/h8-9,11-12H,4-7H2,1-3H3 |
| InChIKey | QBTWCEOAMTVICF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|