C15H17N3O5 — CID 148891313
N-(2-aminoethyl)-2-[7-(hydroxymethyl)-6-nitronaphthalen-2-yl]oxyacetamide (PubChem CID 148891313) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[7-(hydroxymethyl)-6-nitronaphthalen-2-yl]oxyacetamide.
| Compound Name | N-(2-aminoethyl)-2-[7-(hydroxymethyl)-6-nitronaphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 148891313 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(2-aminoethyl)-2-[7-(hydroxymethyl)-6-nitronaphthalen-2-yl]oxyacetamide |
| SMILES | NCCNC(=O)COc1ccc2cc([N+](=O)[O-])c(CO)cc2c1 |
| InChI | InChI=1S/C15H17N3O5/c16-3-4-17-15(20)9-23-13-2-1-10-7-14(18(21)22)12(8-19)5-11(10)6-13/h1-2,5-7,19H,3-4,8-9,16H2,(H,17,20) |
| InChIKey | PEZHQKLUUCPHTO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|