C30H33N3O3 — CID 148895168
benzyl N-[3-[2-amino-1-(5-morpholin-4-yl-3H-inden-1-yl)ethyl]-2-methylphenyl]carbamate (PubChem CID 148895168) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is benzyl N-[3-[2-amino-1-(5-morpholin-4-yl-3H-inden-1-yl)ethyl]-2-methylphenyl]carbamate.
| Compound Name | benzyl N-[3-[2-amino-1-(5-morpholin-4-yl-3H-inden-1-yl)ethyl]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 148895168 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | benzyl N-[3-[2-amino-1-(5-morpholin-4-yl-3H-inden-1-yl)ethyl]-2-methylphenyl]carbamate |
| SMILES | Cc1c(NC(=O)OCc2ccccc2)cccc1C(CN)C1=CCc2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C30H33N3O3/c1-21-25(8-5-9-29(21)32-30(34)36-20-22-6-3-2-4-7-22)28(19-31)27-12-10-23-18-24(11-13-26(23)27)33-14-16-35-17-15-33/h2-9,11-13,18,28H,10,14-17,19-20,31H2,1H3,(H,32,34) |
| InChIKey | PFSHPRNKYMUECY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|