C16H24O — CID 14889937
(1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-3-methylidene-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran (PubChem CID 14889937) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-3-methylidene-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran.
| Compound Name | (1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-3-methylidene-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran |
|---|---|
| PubChem CID | 14889937 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-3-methylidene-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran |
| SMILES | C=C1O[C@@H](C2=CCCC2)[C@@H]2[C@@H](CC[C@H]2C)[C@@H]1C |
| InChI | InChI=1S/C16H24O/c1-10-8-9-14-11(2)12(3)17-16(15(10)14)13-6-4-5-7-13/h6,10-11,14-16H,3-5,7-9H2,1-2H3/t10-,11-,14+,15+,16+/m1/s1 |
| InChIKey | WTTBLCMOKPWEQV-VMICZAGFSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|