C17H22O — CID 155930560
(2R,5S,6S)-3-but-3-enyl-5-prop-2-enoxytricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 155930560) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (2R,5S,6S)-3-but-3-enyl-5-prop-2-enoxytricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (2R,5S,6S)-3-but-3-enyl-5-prop-2-enoxytricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 155930560 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2R,5S,6S)-3-but-3-enyl-5-prop-2-enoxytricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C=CCCC1=C[C@@H](OCC=C)[C@H]2C3C=CC(C3)[C@@H]12 |
| InChI | InChI=1S/C17H22O/c1-3-5-6-12-11-15(18-9-4-2)17-14-8-7-13(10-14)16(12)17/h3-4,7-8,11,13-17H,1-2,5-6,9-10H2/t13?,14?,15-,16-,17-/m1/s1 |
| InChIKey | APYQTJJJTKGIJR-SWHNLWLKSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|