C9H15NO — CID 14891012
4-(2-methylbuta-2,3-dienyl)morpholine (PubChem CID 14891012) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-(2-methylbuta-2,3-dienyl)morpholine.
| Compound Name | 4-(2-methylbuta-2,3-dienyl)morpholine |
|---|---|
| PubChem CID | 14891012 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-(2-methylbuta-2,3-dienyl)morpholine |
| SMILES | C=C=C(C)CN1CCOCC1 |
| InChI | InChI=1S/C9H15NO/c1-3-9(2)8-10-4-6-11-7-5-10/h1,4-8H2,2H3 |
| InChIKey | LISGJLKSURUUQK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |