C12H20N2O2 — CID 131865481
N-[2,2-dimethyl-3-(morpholin-4-ylmethyl)penta-3,4-dienylidene]hydroxylamine (PubChem CID 131865481) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(morpholin-4-ylmethyl)penta-3,4-dienylidene]hydroxylamine.
| Compound Name | N-[2,2-dimethyl-3-(morpholin-4-ylmethyl)penta-3,4-dienylidene]hydroxylamine |
|---|---|
| PubChem CID | 131865481 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-[2,2-dimethyl-3-(morpholin-4-ylmethyl)penta-3,4-dienylidene]hydroxylamine |
| SMILES | C=C=C(CN1CCOCC1)C(C)(C)C=NO |
| InChI | InChI=1S/C12H20N2O2/c1-4-11(12(2,3)10-13-15)9-14-5-7-16-8-6-14/h10,15H,1,5-9H2,2-3H3 |
| InChIKey | GCAJKAOMLOOYNW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|