C22H14F3O4S+ — CID 148918664
4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoic acid (PubChem CID 148918664) has the molecular formula C22H14F3O4S+ and a molecular weight of 431.41 g/mol. Its IUPAC name is 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoic acid.
| Compound Name | 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoic acid |
|---|---|
| PubChem CID | 148918664 |
| Molecular Formula | C22H14F3O4S+ |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1-[s+]1c2ccccc2c(=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H13F3O4S/c1-29-16-8-6-12(21(27)28)10-19(16)30-17-5-3-2-4-14(17)20(26)15-11-13(22(23,24)25)7-9-18(15)30/h2-11H,1H3/p+1 |
| InChIKey | PKBQNCNHOJNHAP-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|