C31H28F3O6S+ — CID 149359753
[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoate (PubChem CID 149359753) has the molecular formula C31H28F3O6S+ and a molecular weight of 585.62 g/mol. Its IUPAC name is [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoate.
| Compound Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoate |
|---|---|
| PubChem CID | 149359753 |
| Molecular Formula | C31H28F3O6S+ |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 4-methoxy-3-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]benzoate |
| SMILES | CCC1(OC(=O)COC(=O)c2ccc(OC)c(-[s+]3c4ccccc4c(=O)c4cc(C(F)(F)F)ccc43)c2)CCCC1 |
| InChI | InChI=1S/C31H28F3O6S/c1-3-30(14-6-7-15-30)40-27(35)18-39-29(37)19-10-12-23(38-2)26(16-19)41-24-9-5-4-8-21(24)28(36)22-17-20(31(32,33)34)11-13-25(22)41/h4-5,8-13,16-17H,3,6-7,14-15,18H2,1-2H3/q+1 |
| InChIKey | YHRFUJPKMIMXND-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|