C35H36F2O10S2 — CID 86712468
1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate (PubChem CID 86712468) has the molecular formula C35H36F2O10S2 and a molecular weight of 718.79 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate.
| Compound Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate |
|---|---|
| PubChem CID | 86712468 |
| Molecular Formula | C35H36F2O10S2 |
| Molecular Weight | 718.79 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].CCC1(OC(=O)COC(=O)c2ccc(OC)c(-[s+]3c4ccccc4c4ccccc43)c2)CCCC1 |
| InChI | InChI=1S/C29H29O5S.C6H8F2O5S/c1-3-29(16-8-9-17-29)34-27(30)19-33-28(31)20-14-15-23(32-2)26(18-20)35-24-12-6-4-10-21(24)22-11-5-7-13-25(22)35;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h4-7,10-15,18H,3,8-9,16-17,19H2,1-2H3;1,3H2,2H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | FNQJGGIGQUGVIZ-UHFFFAOYSA-M |
| XLogP | 7.41 |
| TPSA | 145.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.79 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|