C33H30FO5S+ — CID 169017094
[5-[2-[1-(3-fluorophenyl)cyclopentyl]oxy-2-oxoethoxy]carbonyl-2-methoxyphenyl]-diphenylsulfanium (PubChem CID 169017094) has the molecular formula C33H30FO5S+ and a molecular weight of 557.66 g/mol. Its IUPAC name is [5-[2-[1-(3-fluorophenyl)cyclopentyl]oxy-2-oxoethoxy]carbonyl-2-methoxyphenyl]-diphenylsulfanium.
| Compound Name | [5-[2-[1-(3-fluorophenyl)cyclopentyl]oxy-2-oxoethoxy]carbonyl-2-methoxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017094 |
| Molecular Formula | C33H30FO5S+ |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | [5-[2-[1-(3-fluorophenyl)cyclopentyl]oxy-2-oxoethoxy]carbonyl-2-methoxyphenyl]-diphenylsulfanium |
| SMILES | COc1ccc(C(=O)OCC(=O)OC2(c3cccc(F)c3)CCCC2)cc1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30FO5S/c1-37-29-18-17-24(21-30(29)40(27-13-4-2-5-14-27)28-15-6-3-7-16-28)32(36)38-23-31(35)39-33(19-8-9-20-33)25-11-10-12-26(34)22-25/h2-7,10-18,21-22H,8-9,19-20,23H2,1H3/q+1 |
| InChIKey | LNTBYGFONDSYJB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|