C32H26F3O5S2+ — CID 169017329
[2-oxo-2-[2-[4-(trifluoromethylsulfanyl)phenyl]propan-2-yloxy]ethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate (PubChem CID 169017329) has the molecular formula C32H26F3O5S2+ and a molecular weight of 611.68 g/mol. Its IUPAC name is [2-oxo-2-[2-[4-(trifluoromethylsulfanyl)phenyl]propan-2-yloxy]ethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate.
| Compound Name | [2-oxo-2-[2-[4-(trifluoromethylsulfanyl)phenyl]propan-2-yloxy]ethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate |
|---|---|
| PubChem CID | 169017329 |
| Molecular Formula | C32H26F3O5S2+ |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | [2-oxo-2-[2-[4-(trifluoromethylsulfanyl)phenyl]propan-2-yloxy]ethyl] 3-dibenzothiophen-5-ium-5-yl-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)OC(C)(C)c2ccc(SC(F)(F)F)cc2)cc1-[s+]1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C32H26F3O5S2/c1-31(2,21-13-15-22(16-14-21)41-32(33,34)35)40-29(36)19-39-30(37)20-12-17-25(38-3)28(18-20)42-26-10-6-4-8-23(26)24-9-5-7-11-27(24)42/h4-18H,19H2,1-3H3/q+1 |
| InChIKey | PLHJPQLOCOVIBP-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|