C35H36F2O10S2 — CID 140636024
[2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-[5-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethyl]sulfonyloxydibenzothiophen-5-yl]-4-methoxybenzoate (PubChem CID 140636024) has the molecular formula C35H36F2O10S2 and a molecular weight of 718.79 g/mol. Its IUPAC name is [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-[5-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethyl]sulfonyloxydibenzothiophen-5-yl]-4-methoxybenzoate.
| Compound Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-[5-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethyl]sulfonyloxydibenzothiophen-5-yl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 140636024 |
| Molecular Formula | C35H36F2O10S2 |
| Molecular Weight | 718.79 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | [2-(1-ethylcyclopentyl)oxy-2-oxoethyl] 3-[5-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethyl]sulfonyloxydibenzothiophen-5-yl]-4-methoxybenzoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)OS1(c2cc(C(=O)OCC(=O)OC3(CC)CCCC3)ccc2OC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H36F2O10S2/c1-5-34(18-10-11-19-34)46-31(38)21-44-33(40)24-16-17-27(43-4)30(20-24)48(47-49(41,42)35(36,37)22-45-32(39)23(2)3)28-14-8-6-12-25(28)26-13-7-9-15-29(26)48/h6-9,12-17,20H,2,5,10-11,18-19,21-22H2,1,3-4H3 |
| InChIKey | LDHMYDAFXAVDOW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.79 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|