C38H42F3O4S+ — CID 147124552
10-[5-[(Z)-1-[(Z)-3-cyclobutyl-2-heptoxyprop-2-enoxy]prop-1-enyl]-2-methoxyphenyl]-2-(trifluoromethyl)thioxanthen-10-ium-9-one (PubChem CID 147124552) has the molecular formula C38H42F3O4S+ and a molecular weight of 651.81 g/mol. Its IUPAC name is 10-[5-[(Z)-1-[(Z)-3-cyclobutyl-2-heptoxyprop-2-enoxy]prop-1-enyl]-2-methoxyphenyl]-2-(trifluoromethyl)thioxanthen-10-ium-9-one.
| Compound Name | 10-[5-[(Z)-1-[(Z)-3-cyclobutyl-2-heptoxyprop-2-enoxy]prop-1-enyl]-2-methoxyphenyl]-2-(trifluoromethyl)thioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 147124552 |
| Molecular Formula | C38H42F3O4S+ |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.28 |
| IUPAC Name | 10-[5-[(Z)-1-[(Z)-3-cyclobutyl-2-heptoxyprop-2-enoxy]prop-1-enyl]-2-methoxyphenyl]-2-(trifluoromethyl)thioxanthen-10-ium-9-one |
| SMILES | C/C=C(\OC/C(=C/C1CCC1)OCCCCCCC)c1ccc(OC)c(-[s+]2c3ccccc3c(=O)c3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C38H42F3O4S/c1-4-6-7-8-11-21-44-29(22-26-13-12-14-26)25-45-32(5-2)27-17-19-33(43-3)36(23-27)46-34-16-10-9-15-30(34)37(42)31-24-28(38(39,40)41)18-20-35(31)46/h5,9-10,15-20,22-24,26H,4,6-8,11-14,21,25H2,1-3H3/q+1/b29-22-,32-5- |
| InChIKey | BPAGMEBCYQZMCD-GCHYKBRMSA-N |
| XLogP | 11.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|