4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid

C13H9Cl2NO3 — CID 1489246

IUPAC4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid
SMILESCn1cc(C(=O)c2cccc(Cl)c2Cl)cc1C(=O)O
InChIInChI=1S/C13H9Cl2NO3/c1-16-6-7(5-10(16)13(18)19)12(17)8-3-2-4-9(14)11(8)15/h2-6H,1H3,(H,18,19)
InChIKeyHILCNGIFBTVKQH-UHFFFAOYSA-N
MW298.12 g/mol
LogP3.26
Rot. Bonds3

About 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid

4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid (PubChem CID 1489246) has the molecular formula C13H9Cl2NO3 and a molecular weight of 298.12 g/mol. Its IUPAC name is 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid.

Molecular Properties

Compound Name4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid
PubChem CID1489246
Molecular FormulaC13H9Cl2NO3
Molecular Weight298.12 g/mol
Exact Mass297.00
IUPAC Name4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid
SMILESCn1cc(C(=O)c2cccc(Cl)c2Cl)cc1C(=O)O
InChIInChI=1S/C13H9Cl2NO3/c1-16-6-7(5-10(16)13(18)19)12(17)8-3-2-4-9(14)11(8)15/h2-6H,1H3,(H,18,19)
InChIKeyHILCNGIFBTVKQH-UHFFFAOYSA-N
XLogP3.26
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.12
LogP ≤ 53.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid?
The IUPAC name of 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid (CID 1489246) is 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid.
What is the SMILES notation for 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid?
The canonical SMILES for 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid is Cn1cc(C(=O)c2cccc(Cl)c2Cl)cc1C(=O)O.
What is the InChIKey of 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid?
The InChIKey is HILCNGIFBTVKQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO3/c1-16-6-7(5-10(16)13(18)19)12(17)8-3-2-4-9(14)11(8)15/h2-6H,1H3,(H,18,19).
What are the key properties of 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid?
4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid has a molecular weight of 298.12 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dichlorobenzoyl)-1-methylpyrrole-2-carboxylic acid is sourced from PubChem (CID 1489246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).