C23H24BrNO2S — CID 148942866
(3aR,4S,9bS)-4-(4-bromophenyl)-8-(2-cyclopropylethylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 148942866) has the molecular formula C23H24BrNO2S and a molecular weight of 458.42 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(4-bromophenyl)-8-(2-cyclopropylethylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bS)-4-(4-bromophenyl)-8-(2-cyclopropylethylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 148942866 |
| Molecular Formula | C23H24BrNO2S |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (3aR,4S,9bS)-4-(4-bromophenyl)-8-(2-cyclopropylethylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(CCC1CC1)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C23H24BrNO2S/c24-17-8-6-16(7-9-17)23-20-3-1-2-19(20)21-14-18(10-11-22(21)25-23)28(26,27)13-12-15-4-5-15/h1-2,6-11,14-15,19-20,23,25H,3-5,12-13H2/t19-,20+,23+/m0/s1 |
| InChIKey | POGGLSHZNAGCBK-MIZPHKNDSA-N |
| XLogP | 5.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|