C8H13NO — CID 148972829
7-methyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde (PubChem CID 148972829) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 7-methyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde.
| Compound Name | 7-methyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde |
|---|---|
| PubChem CID | 148972829 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 7-methyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde |
| SMILES | CC1=CCCCCN1C=O |
| InChI | InChI=1S/C8H13NO/c1-8-5-3-2-4-6-9(8)7-10/h5,7H,2-4,6H2,1H3 |
| InChIKey | PUFGJXKTFGAKPV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|