C12H15NO — CID 143407693
7-methyl-2,3,4,6-tetrahydrocyclohepta[b]pyridine-1-carbaldehyde (PubChem CID 143407693) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 7-methyl-2,3,4,6-tetrahydrocyclohepta[b]pyridine-1-carbaldehyde.
| Compound Name | 7-methyl-2,3,4,6-tetrahydrocyclohepta[b]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 143407693 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 7-methyl-2,3,4,6-tetrahydrocyclohepta[b]pyridine-1-carbaldehyde |
| SMILES | CC1=CC=C2C(=CC1)CCCN2C=O |
| InChI | InChI=1S/C12H15NO/c1-10-4-6-11-3-2-8-13(9-14)12(11)7-5-10/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | XOECWELYMPUGLR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|