C49H68N2O4P2 — CID 14897373
N,N,N',N'-tetrabutyl-2,8-bis(diphenylphosphoryl)nonanediamide (PubChem CID 14897373) has the molecular formula C49H68N2O4P2 and a molecular weight of 811.04 g/mol. Its IUPAC name is N,N,N',N'-tetrabutyl-2,8-bis(diphenylphosphoryl)nonanediamide.
| Compound Name | N,N,N',N'-tetrabutyl-2,8-bis(diphenylphosphoryl)nonanediamide |
|---|---|
| PubChem CID | 14897373 |
| Molecular Formula | C49H68N2O4P2 |
| Molecular Weight | 811.04 g/mol |
| Exact Mass | 810.47 |
| IUPAC Name | N,N,N',N'-tetrabutyl-2,8-bis(diphenylphosphoryl)nonanediamide |
| SMILES | CCCCN(CCCC)C(=O)C(CCCCCC(C(=O)N(CCCC)CCCC)P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H68N2O4P2/c1-5-9-38-50(39-10-6-2)48(52)46(56(54,42-28-18-13-19-29-42)43-30-20-14-21-31-43)36-26-17-27-37-47(49(53)51(40-11-7-3)41-12-8-4)57(55,44-32-22-15-23-33-44)45-34-24-16-25-35-45/h13-16,18-25,28-35,46-47H,5-12,17,26-27,36-41H2,1-4H3 |
| InChIKey | LMKSJZWFIDVXSV-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.04 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|