C37H59N2O3P — CID 155903097
N,N,N',N'-tetrabutyl-2-diphenylphosphorylnonanediamide (PubChem CID 155903097) has the molecular formula C37H59N2O3P and a molecular weight of 610.86 g/mol. Its IUPAC name is N,N,N',N'-tetrabutyl-2-diphenylphosphorylnonanediamide.
| Compound Name | N,N,N',N'-tetrabutyl-2-diphenylphosphorylnonanediamide |
|---|---|
| PubChem CID | 155903097 |
| Molecular Formula | C37H59N2O3P |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.43 |
| IUPAC Name | N,N,N',N'-tetrabutyl-2-diphenylphosphorylnonanediamide |
| SMILES | CCCCN(CCCC)C(=O)CCCCCCC(C(=O)N(CCCC)CCCC)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H59N2O3P/c1-5-9-29-38(30-10-6-2)36(40)28-22-14-13-21-27-35(37(41)39(31-11-7-3)32-12-8-4)43(42,33-23-17-15-18-24-33)34-25-19-16-20-26-34/h15-20,23-26,35H,5-14,21-22,27-32H2,1-4H3 |
| InChIKey | HBMNHSPJYPGKLV-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|