C35H41NO3P2 — CID 166606955
2-diphenylphosphoryl-N-(diphenylphosphorylmethyl)-N-octylacetamide (PubChem CID 166606955) has the molecular formula C35H41NO3P2 and a molecular weight of 585.67 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N-(diphenylphosphorylmethyl)-N-octylacetamide.
| Compound Name | 2-diphenylphosphoryl-N-(diphenylphosphorylmethyl)-N-octylacetamide |
|---|---|
| PubChem CID | 166606955 |
| Molecular Formula | C35H41NO3P2 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 2-diphenylphosphoryl-N-(diphenylphosphorylmethyl)-N-octylacetamide |
| SMILES | CCCCCCCCN(CP(=O)(c1ccccc1)c1ccccc1)C(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H41NO3P2/c1-2-3-4-5-6-19-28-36(30-41(39,33-24-15-9-16-25-33)34-26-17-10-18-27-34)35(37)29-40(38,31-20-11-7-12-21-31)32-22-13-8-14-23-32/h7-18,20-27H,2-6,19,28-30H2,1H3 |
| InChIKey | AAXWAXWYBNURRE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|