C34H35N5O6 — CID 148980620
1-benzyl-3-(3,5-dimethoxyphenyl)-7-[4-(2-methoxyethoxy)-2-(2-oxobut-3-enyl)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 148980620) has the molecular formula C34H35N5O6 and a molecular weight of 609.68 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dimethoxyphenyl)-7-[4-(2-methoxyethoxy)-2-(2-oxobut-3-enyl)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-benzyl-3-(3,5-dimethoxyphenyl)-7-[4-(2-methoxyethoxy)-2-(2-oxobut-3-enyl)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 148980620 |
| Molecular Formula | C34H35N5O6 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | 1-benzyl-3-(3,5-dimethoxyphenyl)-7-[4-(2-methoxyethoxy)-2-(2-oxobut-3-enyl)anilino]-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | C=CC(=O)Cc1cc(OCCOC)ccc1Nc1ncc2c(n1)N(Cc1ccccc1)C(=O)N(c1cc(OC)cc(OC)c1)C2 |
| InChI | InChI=1S/C34H35N5O6/c1-5-27(40)15-24-16-28(45-14-13-42-2)11-12-31(24)36-33-35-20-25-22-38(26-17-29(43-3)19-30(18-26)44-4)34(41)39(32(25)37-33)21-23-9-7-6-8-10-23/h5-12,16-20H,1,13-15,21-22H2,2-4H3,(H,35,36,37) |
| InChIKey | PVQVRHRVAHZHRL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|