C29H31F6N3O3S — CID 148983210
(2R,3S)-3-[2-(2-aminoethylsulfanyl)acetyl]-6,6,6-trifluoro-N-[(3S)-4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl]-2-(3,3,3-trifluoropropyl)hexanamide (PubChem CID 148983210) has the molecular formula C29H31F6N3O3S and a molecular weight of 615.64 g/mol. Its IUPAC name is (2R,3S)-3-[2-(2-aminoethylsulfanyl)acetyl]-6,6,6-trifluoro-N-[(3S)-4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl]-2-(3,3,3-trifluoropropyl)hexanamide.
| Compound Name | (2R,3S)-3-[2-(2-aminoethylsulfanyl)acetyl]-6,6,6-trifluoro-N-[(3S)-4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl]-2-(3,3,3-trifluoropropyl)hexanamide |
|---|---|
| PubChem CID | 148983210 |
| Molecular Formula | C29H31F6N3O3S |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | (2R,3S)-3-[2-(2-aminoethylsulfanyl)acetyl]-6,6,6-trifluoro-N-[(3S)-4-oxo-1-phenyl-3,5-dihydro-2-benzazepin-3-yl]-2-(3,3,3-trifluoropropyl)hexanamide |
| SMILES | NCCSCC(=O)[C@@H](CCC(F)(F)F)[C@@H](CCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2CC1=O |
| InChI | InChI=1S/C29H31F6N3O3S/c30-28(31,32)12-10-21(24(40)17-42-15-14-36)22(11-13-29(33,34)35)27(41)38-26-23(39)16-19-8-4-5-9-20(19)25(37-26)18-6-2-1-3-7-18/h1-9,21-22,26H,10-17,36H2,(H,38,41)/t21-,22+,26+/m0/s1 |
| InChIKey | PWDIUPMZYSFIBS-VVZHRXSXSA-N |
| XLogP | 5.27 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|