C29H29F6N2O3Y- — CID 159717770
(2R,3S)-3-acetyl-N-[(3S)-6,8-dimethyl-4-oxo-1-phenyl-5,7-dihydro-3H-2-benzazepin-7-id-3-yl]-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanamide;yttrium (PubChem CID 159717770) has the molecular formula C29H29F6N2O3Y- and a molecular weight of 656.46 g/mol. Its IUPAC name is (2R,3S)-3-acetyl-N-[(3S)-6,8-dimethyl-4-oxo-1-phenyl-5,7-dihydro-3H-2-benzazepin-7-id-3-yl]-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanamide;yttrium.
| Compound Name | (2R,3S)-3-acetyl-N-[(3S)-6,8-dimethyl-4-oxo-1-phenyl-5,7-dihydro-3H-2-benzazepin-7-id-3-yl]-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanamide;yttrium |
|---|---|
| PubChem CID | 159717770 |
| Molecular Formula | C29H29F6N2O3Y- |
| Molecular Weight | 656.46 g/mol |
| Exact Mass | 656.11 |
| IUPAC Name | (2R,3S)-3-acetyl-N-[(3S)-6,8-dimethyl-4-oxo-1-phenyl-5,7-dihydro-3H-2-benzazepin-7-id-3-yl]-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanamide;yttrium |
| SMILES | CC(=O)C(CCC(F)(F)F)[C@@H](CCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccccc2)c2cc(C)[c-]c(C)c2CC1=O.[Y] |
| InChI | InChI=1S/C29H29F6N2O3.Y/c1-16-13-17(2)22-15-24(39)26(36-25(23(22)14-16)19-7-5-4-6-8-19)37-27(40)21(10-12-29(33,34)35)20(18(3)38)9-11-28(30,31)32;/h4-8,14,20-21,26H,9-12,15H2,1-3H3,(H,37,40);/q-1;/t20?,21-,26-;/m1./s1 |
| InChIKey | GFJUJVBWQREJFX-MXZMCTFZSA-N |
| XLogP | 6.01 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|