C25H25N3OS — CID 148987412
2-(4-ethylphenyl)-N-(4-morpholin-4-ylphenyl)thieno[2,3-b]pyridin-6-amine (PubChem CID 148987412) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-(4-morpholin-4-ylphenyl)thieno[2,3-b]pyridin-6-amine.
| Compound Name | 2-(4-ethylphenyl)-N-(4-morpholin-4-ylphenyl)thieno[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 148987412 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-(4-ethylphenyl)-N-(4-morpholin-4-ylphenyl)thieno[2,3-b]pyridin-6-amine |
| SMILES | CCc1ccc(-c2cc3ccc(Nc4ccc(N5CCOCC5)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-2-18-3-5-19(6-4-18)23-17-20-7-12-24(27-25(20)30-23)26-21-8-10-22(11-9-21)28-13-15-29-16-14-28/h3-12,17H,2,13-16H2,1H3,(H,26,27) |
| InChIKey | PXAJQGBYKRHDRL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|