cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid

C8H15NO2 — CID 14901340

IUPACcis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid
SMILESCN[C@H]1CCCC[C@H]1C(=O)O
InChIInChI=1S/C8H15NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7+/m1/s1
InChIKeyWBWLQVJMCJPYHB-RQJHMYQMSA-N
MW157.21 g/mol
LogP0.85
Rot. Bonds2

About cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid

cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid (PubChem CID 14901340) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid
PubChem CID14901340
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Namecis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid
SMILESCN[C@H]1CCCC[C@H]1C(=O)O
InChIInChI=1S/C8H15NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7+/m1/s1
InChIKeyWBWLQVJMCJPYHB-RQJHMYQMSA-N
XLogP0.85
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 50.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid (CID 14901340) is cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid is CN[C@H]1CCCC[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid?
The InChIKey is WBWLQVJMCJPYHB-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H15NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7+/m1/s1.
What are the key properties of cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid?
cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid has a molecular weight of 157.21 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-(methylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 14901340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).