C8H10N4 — CID 149024919
3-N-(2-iminoethylideneamino)benzene-1,3-diamine (PubChem CID 149024919) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 3-N-(2-iminoethylideneamino)benzene-1,3-diamine.
| Compound Name | 3-N-(2-iminoethylideneamino)benzene-1,3-diamine |
|---|---|
| PubChem CID | 149024919 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-N-(2-iminoethylideneamino)benzene-1,3-diamine |
| SMILES | [H]/N=C/C=NNc1cccc(N)c1 |
| InChI | InChI=1S/C8H10N4/c9-4-5-11-12-8-3-1-2-7(10)6-8/h1-6,9,12H,10H2/b9-4+,11-5? |
| InChIKey | QEEXXBKGKPVJLD-ANPCEVTQSA-N |
| XLogP | 1.32 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|