C12H17N3 — CID 175597593
3-[2,2-bis(prop-2-enyl)hydrazinyl]aniline (PubChem CID 175597593) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-[2,2-bis(prop-2-enyl)hydrazinyl]aniline.
| Compound Name | 3-[2,2-bis(prop-2-enyl)hydrazinyl]aniline |
|---|---|
| PubChem CID | 175597593 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-[2,2-bis(prop-2-enyl)hydrazinyl]aniline |
| SMILES | C=CCN(CC=C)Nc1cccc(N)c1 |
| InChI | InChI=1S/C12H17N3/c1-3-8-15(9-4-2)14-12-7-5-6-11(13)10-12/h3-7,10,14H,1-2,8-9,13H2 |
| InChIKey | CHOCCTJKLTWLJS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|