C12H16N2 — CID 170336207
3-N-[(3Z)-hexa-3,5-dien-2-yl]benzene-1,3-diamine (PubChem CID 170336207) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-N-[(3Z)-hexa-3,5-dien-2-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[(3Z)-hexa-3,5-dien-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 170336207 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-N-[(3Z)-hexa-3,5-dien-2-yl]benzene-1,3-diamine |
| SMILES | C=C/C=C\C(C)Nc1cccc(N)c1 |
| InChI | InChI=1S/C12H16N2/c1-3-4-6-10(2)14-12-8-5-7-11(13)9-12/h3-10,14H,1,13H2,2H3/b6-4- |
| InChIKey | UPSMGNFEZNMEJL-XQRVVYSFSA-N |
| XLogP | 2.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|