About 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol
1-(7,7-dimethoxyoctyl)cyclohexan-1-ol (PubChem CID 14903620) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol |
| PubChem CID | 14903620 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol |
| SMILES | COC(C)(CCCCCCC1(O)CCCCC1)OC |
| InChI | InChI=1S/C16H32O3/c1-15(18-2,19-3)11-7-4-5-8-12-16(17)13-9-6-10-14-16/h17H,4-14H2,1-3H3 |
| InChIKey | GSCMFFULNJLPRZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol?
The IUPAC name of 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol (CID 14903620) is 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol.
What is the SMILES notation for 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol?
The canonical SMILES for 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol is COC(C)(CCCCCCC1(O)CCCCC1)OC.
What is the InChIKey of 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol?
The InChIKey is GSCMFFULNJLPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-15(18-2,19-3)11-7-4-5-8-12-16(17)13-9-6-10-14-16/h17H,4-14H2,1-3H3.
What are the key properties of 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol?
1-(7,7-dimethoxyoctyl)cyclohexan-1-ol has a molecular weight of 272.43 g/mol, XLogP of 4.03, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethoxyoctyl)cyclohexan-1-ol is sourced from PubChem (CID 14903620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).