C24H30NOP — CID 149052381
[2-[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane (PubChem CID 149052381) has the molecular formula C24H30NOP and a molecular weight of 379.48 g/mol. Its IUPAC name is [2-[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane.
| Compound Name | [2-[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 149052381 |
| Molecular Formula | C24H30NOP |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [2-[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane |
| SMILES | CCC(C)[C@H]1COC(C2CCCC2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H30NOP/c1-3-18(2)22-17-26-24(25-22)21-15-10-16-23(21)27(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h4-9,11-14,18,21-23H,3,10,15-17H2,1-2H3/t18?,21?,22-,23?/m1/s1 |
| InChIKey | NJMHKGTWXJFAPG-QWHBUMBVSA-N |
| XLogP | 5.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|