About methyl 5-methoxy-1,3-oxazole-2-carboxylate
methyl 5-methoxy-1,3-oxazole-2-carboxylate (PubChem CID 1491126) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is methyl 5-methoxy-1,3-oxazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methoxy-1,3-oxazole-2-carboxylate |
| PubChem CID | 1491126 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | methyl 5-methoxy-1,3-oxazole-2-carboxylate |
| SMILES | COC(=O)c1ncc(OC)o1 |
| InChI | InChI=1S/C6H7NO4/c1-9-4-3-7-5(11-4)6(8)10-2/h3H,1-2H3 |
| InChIKey | VGWHLCLCKMXXIQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-methoxy-1,3-oxazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methoxy-1,3-oxazole-2-carboxylate?
The IUPAC name of methyl 5-methoxy-1,3-oxazole-2-carboxylate (CID 1491126) is methyl 5-methoxy-1,3-oxazole-2-carboxylate.
What is the SMILES notation for methyl 5-methoxy-1,3-oxazole-2-carboxylate?
The canonical SMILES for methyl 5-methoxy-1,3-oxazole-2-carboxylate is COC(=O)c1ncc(OC)o1.
What is the InChIKey of methyl 5-methoxy-1,3-oxazole-2-carboxylate?
The InChIKey is VGWHLCLCKMXXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4/c1-9-4-3-7-5(11-4)6(8)10-2/h3H,1-2H3.
What are the key properties of methyl 5-methoxy-1,3-oxazole-2-carboxylate?
methyl 5-methoxy-1,3-oxazole-2-carboxylate has a molecular weight of 157.12 g/mol, XLogP of 0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxy-1,3-oxazole-2-carboxylate is sourced from PubChem (CID 1491126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).