About 5-ethoxy-2-methyl-1,3-oxazole
5-ethoxy-2-methyl-1,3-oxazole (PubChem CID 3413886) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-ethoxy-2-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-ethoxy-2-methyl-1,3-oxazole |
| PubChem CID | 3413886 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-ethoxy-2-methyl-1,3-oxazole |
| SMILES | CCOc1cnc(C)o1 |
| InChI | InChI=1S/C6H9NO2/c1-3-8-6-4-7-5(2)9-6/h4H,3H2,1-2H3 |
| InChIKey | XIUYTOWSBLPGDK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-2-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2-methyl-1,3-oxazole?
The IUPAC name of 5-ethoxy-2-methyl-1,3-oxazole (CID 3413886) is 5-ethoxy-2-methyl-1,3-oxazole.
What is the SMILES notation for 5-ethoxy-2-methyl-1,3-oxazole?
The canonical SMILES for 5-ethoxy-2-methyl-1,3-oxazole is CCOc1cnc(C)o1.
What is the InChIKey of 5-ethoxy-2-methyl-1,3-oxazole?
The InChIKey is XIUYTOWSBLPGDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-3-8-6-4-7-5(2)9-6/h4H,3H2,1-2H3.
What are the key properties of 5-ethoxy-2-methyl-1,3-oxazole?
5-ethoxy-2-methyl-1,3-oxazole has a molecular weight of 127.14 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2-methyl-1,3-oxazole is sourced from PubChem (CID 3413886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).