About 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one
3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one (PubChem CID 149114843) has the molecular formula C8H13F3OS
and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one.
Analyze 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one?
The IUPAC name of 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one (CID 149114843) is 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one.
What is the SMILES notation for 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one?
The canonical SMILES for 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one is CC(=O)C(C)(C)SCCC(F)(F)F.
What is the InChIKey of 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one?
The InChIKey is QYEBFZMJPLBCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3OS/c1-6(12)7(2,3)13-5-4-8(9,10)11/h4-5H2,1-3H3.
What are the key properties of 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one?
3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one has a molecular weight of 214.25 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(3,3,3-trifluoropropylsulfanyl)butan-2-one is sourced from PubChem (CID 149114843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).