C15H25NO2 — CID 149119324
2-[(1R,3S,7R,8S)-7-(aminomethyl)-3,8-dimethylspiro[bicyclo[4.2.0]octane-2,1'-cyclopropane]-7-yl]acetic acid (PubChem CID 149119324) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[(1R,3S,7R,8S)-7-(aminomethyl)-3,8-dimethylspiro[bicyclo[4.2.0]octane-2,1'-cyclopropane]-7-yl]acetic acid.
| Compound Name | 2-[(1R,3S,7R,8S)-7-(aminomethyl)-3,8-dimethylspiro[bicyclo[4.2.0]octane-2,1'-cyclopropane]-7-yl]acetic acid |
|---|---|
| PubChem CID | 149119324 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-[(1R,3S,7R,8S)-7-(aminomethyl)-3,8-dimethylspiro[bicyclo[4.2.0]octane-2,1'-cyclopropane]-7-yl]acetic acid |
| SMILES | C[C@H]1CCC2[C@@H]([C@H](C)[C@]2(CN)CC(=O)O)C12CC2 |
| InChI | InChI=1S/C15H25NO2/c1-9-3-4-11-13(14(9)5-6-14)10(2)15(11,8-16)7-12(17)18/h9-11,13H,3-8,16H2,1-2H3,(H,17,18)/t9-,10-,11?,13+,15+/m0/s1 |
| InChIKey | QZFAXYQMLLMJRC-OQNHRQIISA-N |
| XLogP | 2.50 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |