2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid

C12H18FNO2 — CID 134355859

IUPAC2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid
SMILESNCC1(CC(=O)O)C2CCC3(F)CC2C1C3
InChIInChI=1S/C12H18FNO2/c13-11-2-1-8-7(3-11)9(4-11)12(8,6-14)5-10(15)16/h7-9H,1-6,14H2,(H,15,16)
InChIKeyQPQIWPVFMYYMEC-UHFFFAOYSA-N
MW227.28 g/mol
LogP1.56
Rot. Bonds3

About 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid

2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (PubChem CID 134355859) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.

Molecular Properties

Compound Name2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid
PubChem CID134355859
Molecular FormulaC12H18FNO2
Molecular Weight227.28 g/mol
Exact Mass227.13
IUPAC Name2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid
SMILESNCC1(CC(=O)O)C2CCC3(F)CC2C1C3
InChIInChI=1S/C12H18FNO2/c13-11-2-1-8-7(3-11)9(4-11)12(8,6-14)5-10(15)16/h7-9H,1-6,14H2,(H,15,16)
InChIKeyQPQIWPVFMYYMEC-UHFFFAOYSA-N
XLogP1.56
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.28
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
The IUPAC name of 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (CID 134355859) is 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.
What is the SMILES notation for 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
The canonical SMILES for 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid is NCC1(CC(=O)O)C2CCC3(F)CC2C1C3.
What is the InChIKey of 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
The InChIKey is QPQIWPVFMYYMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO2/c13-11-2-1-8-7(3-11)9(4-11)12(8,6-14)5-10(15)16/h7-9H,1-6,14H2,(H,15,16).
What are the key properties of 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid has a molecular weight of 227.28 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-6-fluoro-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid is sourced from PubChem (CID 134355859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).