C14H21NO2 — CID 134355868
2-[2-(aminomethyl)-7-ethenyl-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (PubChem CID 134355868) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-7-ethenyl-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.
| Compound Name | 2-[2-(aminomethyl)-7-ethenyl-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
|---|---|
| PubChem CID | 134355868 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-[2-(aminomethyl)-7-ethenyl-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
| SMILES | C=CC1C2CCC3C1C(C2)C3(CN)CC(=O)O |
| InChI | InChI=1S/C14H21NO2/c1-2-9-8-3-4-10-13(9)11(5-8)14(10,7-15)6-12(16)17/h2,8-11,13H,1,3-7,15H2,(H,16,17) |
| InChIKey | JVXPQFYTNCLKTQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|