C14H23NO2 — CID 167169007
2-[(1R,2R,3S,7S,9R)-2-(aminomethyl)-9-methyl-2-tricyclo[5.2.1.03,9]decanyl]acetic acid (PubChem CID 167169007) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-[(1R,2R,3S,7S,9R)-2-(aminomethyl)-9-methyl-2-tricyclo[5.2.1.03,9]decanyl]acetic acid.
| Compound Name | 2-[(1R,2R,3S,7S,9R)-2-(aminomethyl)-9-methyl-2-tricyclo[5.2.1.03,9]decanyl]acetic acid |
|---|---|
| PubChem CID | 167169007 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-[(1R,2R,3S,7S,9R)-2-(aminomethyl)-9-methyl-2-tricyclo[5.2.1.03,9]decanyl]acetic acid |
| SMILES | C[C@@]12C[C@H]3CCC[C@@H]1[C@](CN)(CC(=O)O)[C@@H]2C3 |
| InChI | InChI=1S/C14H23NO2/c1-13-6-9-3-2-4-10(13)14(8-15,7-12(16)17)11(13)5-9/h9-11H,2-8,15H2,1H3,(H,16,17)/t9-,10-,11+,13+,14+/m0/s1 |
| InChIKey | JOBZLIDUTUTKQM-APLVYKGISA-N |
| XLogP | 2.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |